About 1-phenylethyl (2S)-2-(dimethylamino)-2-(2-fluorophenyl)acetate
1-phenylethyl (2S)-2-(dimethylamino)-2-(2-fluorophenyl)acetate (PubChem CID 70865763) has the molecular formula C18H20FNO2
and a molecular weight of 301.36 g/mol. Its IUPAC name is 1-phenylethyl (2S)-2-(dimethylamino)-2-(2-fluorophenyl)acetate.
Molecular Properties
| Compound Name | 1-phenylethyl (2S)-2-(dimethylamino)-2-(2-fluorophenyl)acetate |
| PubChem CID | 70865763 |
| Molecular Formula | C18H20FNO2 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-phenylethyl (2S)-2-(dimethylamino)-2-(2-fluorophenyl)acetate |
| SMILES | CC(OC(=O)[C@H](c1ccccc1F)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H20FNO2/c1-13(14-9-5-4-6-10-14)22-18(21)17(20(2)3)15-11-7-8-12-16(15)19/h4-13,17H,1-3H3/t13?,17-/m0/s1 |
| InChIKey | GFRABURJAGGVIU-RUINGEJQSA-N |
| XLogP | 3.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenylethyl (2S)-2-(dimethylamino)-2-(2-fluorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethyl (2S)-2-(dimethylamino)-2-(2-fluorophenyl)acetate?
The IUPAC name of 1-phenylethyl (2S)-2-(dimethylamino)-2-(2-fluorophenyl)acetate (CID 70865763) is 1-phenylethyl (2S)-2-(dimethylamino)-2-(2-fluorophenyl)acetate.
What is the SMILES notation for 1-phenylethyl (2S)-2-(dimethylamino)-2-(2-fluorophenyl)acetate?
The canonical SMILES for 1-phenylethyl (2S)-2-(dimethylamino)-2-(2-fluorophenyl)acetate is CC(OC(=O)[C@H](c1ccccc1F)N(C)C)c1ccccc1.
What is the InChIKey of 1-phenylethyl (2S)-2-(dimethylamino)-2-(2-fluorophenyl)acetate?
The InChIKey is GFRABURJAGGVIU-RUINGEJQSA-N. The full InChI is InChI=1S/C18H20FNO2/c1-13(14-9-5-4-6-10-14)22-18(21)17(20(2)3)15-11-7-8-12-16(15)19/h4-13,17H,1-3H3/t13?,17-/m0/s1.
What are the key properties of 1-phenylethyl (2S)-2-(dimethylamino)-2-(2-fluorophenyl)acetate?
1-phenylethyl (2S)-2-(dimethylamino)-2-(2-fluorophenyl)acetate has a molecular weight of 301.36 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethyl (2S)-2-(dimethylamino)-2-(2-fluorophenyl)acetate is sourced from PubChem (CID 70865763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).