C16H21NO2 — CID 70866496
ethyl 6-(2-methylbutan-2-yl)-1H-indole-7-carboxylate (PubChem CID 70866496) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is ethyl 6-(2-methylbutan-2-yl)-1H-indole-7-carboxylate.
| Compound Name | ethyl 6-(2-methylbutan-2-yl)-1H-indole-7-carboxylate |
|---|---|
| PubChem CID | 70866496 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | ethyl 6-(2-methylbutan-2-yl)-1H-indole-7-carboxylate |
| SMILES | CCOC(=O)c1c(C(C)(C)CC)ccc2cc[nH]c12 |
| InChI | InChI=1S/C16H21NO2/c1-5-16(3,4)12-8-7-11-9-10-17-14(11)13(12)15(18)19-6-2/h7-10,17H,5-6H2,1-4H3 |
| InChIKey | BNYLOLBAKMYNET-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |