C19H19BrN2O2 — CID 70870491
3-[(5-bromo-6-phenylfuro[2,3-d]pyrimidin-4-yl)methyl]cyclohexan-1-ol (PubChem CID 70870491) has the molecular formula C19H19BrN2O2 and a molecular weight of 387.28 g/mol. Its IUPAC name is 3-[(5-bromo-6-phenylfuro[2,3-d]pyrimidin-4-yl)methyl]cyclohexan-1-ol.
| Compound Name | 3-[(5-bromo-6-phenylfuro[2,3-d]pyrimidin-4-yl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 70870491 |
| Molecular Formula | C19H19BrN2O2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 3-[(5-bromo-6-phenylfuro[2,3-d]pyrimidin-4-yl)methyl]cyclohexan-1-ol |
| SMILES | OC1CCCC(Cc2ncnc3oc(-c4ccccc4)c(Br)c23)C1 |
| InChI | InChI=1S/C19H19BrN2O2/c20-17-16-15(10-12-5-4-8-14(23)9-12)21-11-22-19(16)24-18(17)13-6-2-1-3-7-13/h1-3,6-7,11-12,14,23H,4-5,8-10H2 |
| InChIKey | OMKGLTPSFOIQTL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |