C14H19BrO — CID 64515099
3-[(3-bromophenyl)methyl]cycloheptan-1-ol (PubChem CID 64515099) has the molecular formula C14H19BrO and a molecular weight of 283.21 g/mol. Its IUPAC name is 3-[(3-bromophenyl)methyl]cycloheptan-1-ol.
| Compound Name | 3-[(3-bromophenyl)methyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 64515099 |
| Molecular Formula | C14H19BrO |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-[(3-bromophenyl)methyl]cycloheptan-1-ol |
| SMILES | OC1CCCCC(Cc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C14H19BrO/c15-13-6-3-5-11(9-13)8-12-4-1-2-7-14(16)10-12/h3,5-6,9,12,14,16H,1-2,4,7-8,10H2 |
| InChIKey | OQNBNRPZLRWGAC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |