C14H10FNO4S2 — CID 70870563
2-[[5-[2-(4-fluorophenyl)ethynyl]thiophen-2-yl]sulfonylamino]acetic acid (PubChem CID 70870563) has the molecular formula C14H10FNO4S2 and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[[5-[2-(4-fluorophenyl)ethynyl]thiophen-2-yl]sulfonylamino]acetic acid.
| Compound Name | 2-[[5-[2-(4-fluorophenyl)ethynyl]thiophen-2-yl]sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 70870563 |
| Molecular Formula | C14H10FNO4S2 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 2-[[5-[2-(4-fluorophenyl)ethynyl]thiophen-2-yl]sulfonylamino]acetic acid |
| SMILES | O=C(O)CNS(=O)(=O)c1ccc(C#Cc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C14H10FNO4S2/c15-11-4-1-10(2-5-11)3-6-12-7-8-14(21-12)22(19,20)16-9-13(17)18/h1-2,4-5,7-8,16H,9H2,(H,17,18) |
| InChIKey | XOGJDUHBVDGSDJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|