C12H15N3 — CID 70874720
N-(imidazo[1,2-a]pyridin-8-ylmethyl)cyclobutanamine (PubChem CID 70874720) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyridin-8-ylmethyl)cyclobutanamine.
| Compound Name | N-(imidazo[1,2-a]pyridin-8-ylmethyl)cyclobutanamine |
|---|---|
| PubChem CID | 70874720 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | N-(imidazo[1,2-a]pyridin-8-ylmethyl)cyclobutanamine |
| SMILES | c1cc(CNC2CCC2)c2nccn2c1 |
| InChI | InChI=1S/C12H15N3/c1-4-11(5-1)14-9-10-3-2-7-15-8-6-13-12(10)15/h2-3,6-8,11,14H,1,4-5,9H2 |
| InChIKey | TUQRMNQRRMOTRC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |