C22H28O — CID 70876576
4,7-dibutyl-5-phenyl-1,3-dihydro-2-benzofuran (PubChem CID 70876576) has the molecular formula C22H28O and a molecular weight of 308.46 g/mol. Its IUPAC name is 4,7-dibutyl-5-phenyl-1,3-dihydro-2-benzofuran.
| Compound Name | 4,7-dibutyl-5-phenyl-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 70876576 |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 4,7-dibutyl-5-phenyl-1,3-dihydro-2-benzofuran |
| SMILES | CCCCc1cc(-c2ccccc2)c(CCCC)c2c1COC2 |
| InChI | InChI=1S/C22H28O/c1-3-5-10-18-14-20(17-11-8-7-9-12-17)19(13-6-4-2)22-16-23-15-21(18)22/h7-9,11-12,14H,3-6,10,13,15-16H2,1-2H3 |
| InChIKey | LJEMHGPFWQQCLT-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |