C18H18N4 — CID 70876978
N-[(Z)-4-phenylbutylideneamino]phthalazin-1-amine (PubChem CID 70876978) has the molecular formula C18H18N4 and a molecular weight of 290.37 g/mol. Its IUPAC name is N-[(Z)-4-phenylbutylideneamino]phthalazin-1-amine.
| Compound Name | N-[(Z)-4-phenylbutylideneamino]phthalazin-1-amine |
|---|---|
| PubChem CID | 70876978 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-[(Z)-4-phenylbutylideneamino]phthalazin-1-amine |
| SMILES | C(\CCCc1ccccc1)=N\Nc1nncc2ccccc12 |
| InChI | InChI=1S/C18H18N4/c1-2-8-15(9-3-1)10-6-7-13-19-21-18-17-12-5-4-11-16(17)14-20-22-18/h1-5,8-9,11-14H,6-7,10H2,(H,21,22)/b19-13- |
| InChIKey | HKCUULJYSVLBRH-UYRXBGFRSA-N |
| XLogP | 4.05 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|