C16H23NO2 — CID 708780
[(4R)-1,3,3-trimethyl-4-phenylpiperidin-4-yl] acetate (PubChem CID 708780) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is [(4R)-1,3,3-trimethyl-4-phenylpiperidin-4-yl] acetate.
| Compound Name | [(4R)-1,3,3-trimethyl-4-phenylpiperidin-4-yl] acetate |
|---|---|
| PubChem CID | 708780 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | [(4R)-1,3,3-trimethyl-4-phenylpiperidin-4-yl] acetate |
| SMILES | CC(=O)O[C@@]1(c2ccccc2)CCN(C)CC1(C)C |
| InChI | InChI=1S/C16H23NO2/c1-13(18)19-16(14-8-6-5-7-9-14)10-11-17(4)12-15(16,2)3/h5-9H,10-12H2,1-4H3/t16-/m1/s1 |
| InChIKey | PKHXKOWXJNZTIG-MRXNPFEDSA-N |
| XLogP | 2.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |