C23H25BrN2O — CID 70879102
(5-bromo-1H-indol-2-yl)-[4-ethyl-4-(2-methylphenyl)piperidin-1-yl]methanone (PubChem CID 70879102) has the molecular formula C23H25BrN2O and a molecular weight of 425.37 g/mol. Its IUPAC name is (5-bromo-1H-indol-2-yl)-[4-ethyl-4-(2-methylphenyl)piperidin-1-yl]methanone.
| Compound Name | (5-bromo-1H-indol-2-yl)-[4-ethyl-4-(2-methylphenyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 70879102 |
| Molecular Formula | C23H25BrN2O |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | (5-bromo-1H-indol-2-yl)-[4-ethyl-4-(2-methylphenyl)piperidin-1-yl]methanone |
| SMILES | CCC1(c2ccccc2C)CCN(C(=O)c2cc3cc(Br)ccc3[nH]2)CC1 |
| InChI | InChI=1S/C23H25BrN2O/c1-3-23(19-7-5-4-6-16(19)2)10-12-26(13-11-23)22(27)21-15-17-14-18(24)8-9-20(17)25-21/h4-9,14-15,25H,3,10-13H2,1-2H3 |
| InChIKey | NFUWDUMEHCGBEG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |