C25H28Cl2N2O6S — CID 70880141
dimethyl 2-[(1S,2R)-2-[(2,3-dichloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-2-(3-methoxypropyl)propanedioate (PubChem CID 70880141) has the molecular formula C25H28Cl2N2O6S and a molecular weight of 555.48 g/mol. Its IUPAC name is dimethyl 2-[(1S,2R)-2-[(2,3-dichloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-2-(3-methoxypropyl)propanedioate.
| Compound Name | dimethyl 2-[(1S,2R)-2-[(2,3-dichloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-2-(3-methoxypropyl)propanedioate |
|---|---|
| PubChem CID | 70880141 |
| Molecular Formula | C25H28Cl2N2O6S |
| Molecular Weight | 555.48 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | dimethyl 2-[(1S,2R)-2-[(2,3-dichloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-2-(3-methoxypropyl)propanedioate |
| SMILES | COCCCC(C(=O)OC)(C(=O)OC)[C@@H]1C2C=CC=CC2C[C@H]1NC(=O)c1cc2sc(Cl)c(Cl)c2[nH]1 |
| InChI | InChI=1S/C25H28Cl2N2O6S/c1-33-10-6-9-25(23(31)34-2,24(32)35-3)18-14-8-5-4-7-13(14)11-15(18)29-22(30)16-12-17-20(28-16)19(26)21(27)36-17/h4-5,7-8,12-15,18,28H,6,9-11H2,1-3H3,(H,29,30)/t13?,14?,15-,18-/m1/s1 |
| InChIKey | ZUVLOODSDLVXEO-PPPKJHQXSA-N |
| XLogP | 4.77 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|