C24H32N4O3S — CID 70880779
(4,6-dimethyl-2-methylsulfonylpyrimidin-5-yl)-[2-[(3S)-3-phenylbutyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 70880779) has the molecular formula C24H32N4O3S and a molecular weight of 456.61 g/mol. Its IUPAC name is (4,6-dimethyl-2-methylsulfonylpyrimidin-5-yl)-[2-[(3S)-3-phenylbutyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | (4,6-dimethyl-2-methylsulfonylpyrimidin-5-yl)-[2-[(3S)-3-phenylbutyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 70880779 |
| Molecular Formula | C24H32N4O3S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | (4,6-dimethyl-2-methylsulfonylpyrimidin-5-yl)-[2-[(3S)-3-phenylbutyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | Cc1nc(S(C)(=O)=O)nc(C)c1C(=O)N1CC2CN(CC[C@H](C)c3ccccc3)CC2C1 |
| InChI | InChI=1S/C24H32N4O3S/c1-16(19-8-6-5-7-9-19)10-11-27-12-20-14-28(15-21(20)13-27)23(29)22-17(2)25-24(26-18(22)3)32(4,30)31/h5-9,16,20-21H,10-15H2,1-4H3/t16-,20?,21?/m0/s1 |
| InChIKey | FXOURYIXYPOTPH-ATIQYGATSA-N |
| XLogP | 2.69 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |