C28H38N4O4 — CID 58945163
methyl (2R)-3-[4,6-dimethyl-5-[2-[(3S)-3-phenylbutyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrimidin-2-yl]oxy-2-methylpropanoate (PubChem CID 58945163) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is methyl (2R)-3-[4,6-dimethyl-5-[2-[(3S)-3-phenylbutyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrimidin-2-yl]oxy-2-methylpropanoate.
| Compound Name | methyl (2R)-3-[4,6-dimethyl-5-[2-[(3S)-3-phenylbutyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrimidin-2-yl]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 58945163 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | methyl (2R)-3-[4,6-dimethyl-5-[2-[(3S)-3-phenylbutyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrimidin-2-yl]oxy-2-methylpropanoate |
| SMILES | COC(=O)[C@H](C)COc1nc(C)c(C(=O)N2CC3CN(CC[C@H](C)c4ccccc4)CC3C2)c(C)n1 |
| InChI | InChI=1S/C28H38N4O4/c1-18(22-9-7-6-8-10-22)11-12-31-13-23-15-32(16-24(23)14-31)26(33)25-20(3)29-28(30-21(25)4)36-17-19(2)27(34)35-5/h6-10,18-19,23-24H,11-17H2,1-5H3/t18-,19+,23?,24?/m0/s1 |
| InChIKey | DPCXDCJFTZBBBL-DKMITMCCSA-N |
| XLogP | 3.48 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |