C12H18N2O2 — CID 70881179
3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid (PubChem CID 70881179) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid.
| Compound Name | 3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 70881179 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid |
| SMILES | CCn1ncc2c1CCCC2CCC(=O)O |
| InChI | InChI=1S/C12H18N2O2/c1-2-14-11-5-3-4-9(6-7-12(15)16)10(11)8-13-14/h8-9H,2-7H2,1H3,(H,15,16) |
| InChIKey | JKXJORPHXCNJGC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |