3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid

C12H18N2O2 — CID 70881179

IUPAC3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid
SMILESCCn1ncc2c1CCCC2CCC(=O)O
InChIInChI=1S/C12H18N2O2/c1-2-14-11-5-3-4-9(6-7-12(15)16)10(11)8-13-14/h8-9H,2-7H2,1H3,(H,15,16)
InChIKeyJKXJORPHXCNJGC-UHFFFAOYSA-N
MW222.29 g/mol
LogP2.19
Rot. Bonds4

About 3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid

3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid (PubChem CID 70881179) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid.

Molecular Properties

Compound Name3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid
PubChem CID70881179
Molecular FormulaC12H18N2O2
Molecular Weight222.29 g/mol
Exact Mass222.14
IUPAC Name3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid
SMILESCCn1ncc2c1CCCC2CCC(=O)O
InChIInChI=1S/C12H18N2O2/c1-2-14-11-5-3-4-9(6-7-12(15)16)10(11)8-13-14/h8-9H,2-7H2,1H3,(H,15,16)
InChIKeyJKXJORPHXCNJGC-UHFFFAOYSA-N
XLogP2.19
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.29
LogP ≤ 52.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid?
The IUPAC name of 3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid (CID 70881179) is 3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid.
What is the SMILES notation for 3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid?
The canonical SMILES for 3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid is CCn1ncc2c1CCCC2CCC(=O)O.
What is the InChIKey of 3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid?
The InChIKey is JKXJORPHXCNJGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-2-14-11-5-3-4-9(6-7-12(15)16)10(11)8-13-14/h8-9H,2-7H2,1H3,(H,15,16).
What are the key properties of 3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid?
3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid has a molecular weight of 222.29 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethyl-4,5,6,7-tetrahydroindazol-4-yl)propanoic acid is sourced from PubChem (CID 70881179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).