C13H23FO4S — CID 70881665
methyl 1-[(1-fluoro-2-methylpropan-2-yl)sulfonylmethyl]cyclohexane-1-carboxylate (PubChem CID 70881665) has the molecular formula C13H23FO4S and a molecular weight of 294.39 g/mol. Its IUPAC name is methyl 1-[(1-fluoro-2-methylpropan-2-yl)sulfonylmethyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[(1-fluoro-2-methylpropan-2-yl)sulfonylmethyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70881665 |
| Molecular Formula | C13H23FO4S |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | methyl 1-[(1-fluoro-2-methylpropan-2-yl)sulfonylmethyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(CS(=O)(=O)C(C)(C)CF)CCCCC1 |
| InChI | InChI=1S/C13H23FO4S/c1-12(2,9-14)19(16,17)10-13(11(15)18-3)7-5-4-6-8-13/h4-10H2,1-3H3 |
| InChIKey | IYXMDLYTEQYTHG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |