C35H31N — CID 70886316
13,13-dimethyl-5,10-bis(4-methylphenyl)-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),17-octaene (PubChem CID 70886316) has the molecular formula C35H31N and a molecular weight of 465.64 g/mol. Its IUPAC name is 13,13-dimethyl-5,10-bis(4-methylphenyl)-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),17-octaene.
| Compound Name | 13,13-dimethyl-5,10-bis(4-methylphenyl)-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),17-octaene |
|---|---|
| PubChem CID | 70886316 |
| Molecular Formula | C35H31N |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 13,13-dimethyl-5,10-bis(4-methylphenyl)-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),17-octaene |
| SMILES | Cc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C)cc4)cc4c2n3C2=C(CCC=C2)C4(C)C)cc1 |
| InChI | InChI=1S/C35H31N/c1-22-9-13-24(14-10-22)26-17-18-32-28(19-26)29-20-27(25-15-11-23(2)12-16-25)21-31-34(29)36(32)33-8-6-5-7-30(33)35(31,3)4/h6,8-21H,5,7H2,1-4H3 |
| InChIKey | HVGKKJPAXFTPPQ-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |