C45H39N — CID 70893002
8,8,14,14-tetramethyl-5,11,17-tris(4-methylphenyl)-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene (PubChem CID 70893002) has the molecular formula C45H39N and a molecular weight of 593.81 g/mol. Its IUPAC name is 8,8,14,14-tetramethyl-5,11,17-tris(4-methylphenyl)-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene.
| Compound Name | 8,8,14,14-tetramethyl-5,11,17-tris(4-methylphenyl)-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 70893002 |
| Molecular Formula | C45H39N |
| Molecular Weight | 593.81 g/mol |
| Exact Mass | 593.31 |
| IUPAC Name | 8,8,14,14-tetramethyl-5,11,17-tris(4-methylphenyl)-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
| SMILES | Cc1ccc(-c2cc3c4c(c2)C(C)(C)c2cc(-c5ccc(C)cc5)cc5c6cc(-c7ccc(C)cc7)cc(c6n-4c25)C3(C)C)cc1 |
| InChI | InChI=1S/C45H39N/c1-26-8-14-29(15-9-26)32-20-35-36-21-33(30-16-10-27(2)11-17-30)23-38-42(36)46-41(35)37(22-32)44(4,5)39-24-34(31-18-12-28(3)13-19-31)25-40(43(39)46)45(38,6)7/h8-25H,1-7H3 |
| InChIKey | SAJMQXKKMZWVBH-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.81 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |