C47H36N2 — CID 146434699
11-(2,6-dimethyl-10-phenylanthracen-9-yl)-8,8,14,14-tetramethyl-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene-5-carbonitrile (PubChem CID 146434699) has the molecular formula C47H36N2 and a molecular weight of 628.82 g/mol. Its IUPAC name is 11-(2,6-dimethyl-10-phenylanthracen-9-yl)-8,8,14,14-tetramethyl-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene-5-carbonitrile.
| Compound Name | 11-(2,6-dimethyl-10-phenylanthracen-9-yl)-8,8,14,14-tetramethyl-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene-5-carbonitrile |
|---|---|
| PubChem CID | 146434699 |
| Molecular Formula | C47H36N2 |
| Molecular Weight | 628.82 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | 11-(2,6-dimethyl-10-phenylanthracen-9-yl)-8,8,14,14-tetramethyl-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene-5-carbonitrile |
| SMILES | Cc1ccc2c(-c3cc4c5c(c3)C(C)(C)c3cc(C#N)cc6c7cccc(c7n-5c36)C4(C)C)c3cc(C)ccc3c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C47H36N2/c1-26-16-18-32-34(19-26)41(29-11-8-7-9-12-29)31-17-15-27(2)20-35(31)42(32)30-23-39-45-40(24-30)47(5,6)38-22-28(25-48)21-36-33-13-10-14-37(46(39,3)4)43(33)49(45)44(36)38/h7-24H,1-6H3 |
| InChIKey | SGMWVMDMDKOAEE-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.82 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|