C45H31N3 — CID 146434700
16-(2,6-dimethyl-10-phenylanthracen-9-yl)-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene-5,10-dicarbonitrile (PubChem CID 146434700) has the molecular formula C45H31N3 and a molecular weight of 613.76 g/mol. Its IUPAC name is 16-(2,6-dimethyl-10-phenylanthracen-9-yl)-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene-5,10-dicarbonitrile.
| Compound Name | 16-(2,6-dimethyl-10-phenylanthracen-9-yl)-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene-5,10-dicarbonitrile |
|---|---|
| PubChem CID | 146434700 |
| Molecular Formula | C45H31N3 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | 16-(2,6-dimethyl-10-phenylanthracen-9-yl)-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene-5,10-dicarbonitrile |
| SMILES | Cc1ccc2c(-c3ccc4c(c3)C(C)(C)c3cc(C#N)cc5c6cc(C#N)ccc6n-4c35)c3cc(C)ccc3c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C45H31N3/c1-26-11-15-33-35(18-26)42(30-8-6-5-7-9-30)32-14-10-27(2)19-36(32)43(33)31-13-17-41-38(23-31)45(3,4)39-22-29(25-47)21-37-34-20-28(24-46)12-16-40(34)48(41)44(37)39/h5-23H,1-4H3 |
| InChIKey | VHEOUSIWGRTARA-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 52.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|