C12H26N2O — CID 70887236
3-[(1-ethylpyrrolidin-2-yl)methoxy]-N,N-dimethylpropan-1-amine (PubChem CID 70887236) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 3-[(1-ethylpyrrolidin-2-yl)methoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(1-ethylpyrrolidin-2-yl)methoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 70887236 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 3-[(1-ethylpyrrolidin-2-yl)methoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CCN1CCCC1COCCCN(C)C |
| InChI | InChI=1S/C12H26N2O/c1-4-14-9-5-7-12(14)11-15-10-6-8-13(2)3/h12H,4-11H2,1-3H3 |
| InChIKey | BUNPLFOFBIENJW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|