C33H42N6O5S — CID 70887366
7-[(3,4-diethoxyphenyl)methyl]-8-[2-(2,8-dimethyl-3,4,4a,6,7,9b-hexahydro-1H-pyrido[4,3-b]indol-5-yl)-2-oxoethyl]sulfanyl-1,3-dimethylpurine-2,6-dione (PubChem CID 70887366) has the molecular formula C33H42N6O5S and a molecular weight of 634.80 g/mol. Its IUPAC name is 7-[(3,4-diethoxyphenyl)methyl]-8-[2-(2,8-dimethyl-3,4,4a,6,7,9b-hexahydro-1H-pyrido[4,3-b]indol-5-yl)-2-oxoethyl]sulfanyl-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(3,4-diethoxyphenyl)methyl]-8-[2-(2,8-dimethyl-3,4,4a,6,7,9b-hexahydro-1H-pyrido[4,3-b]indol-5-yl)-2-oxoethyl]sulfanyl-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 70887366 |
| Molecular Formula | C33H42N6O5S |
| Molecular Weight | 634.80 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | 7-[(3,4-diethoxyphenyl)methyl]-8-[2-(2,8-dimethyl-3,4,4a,6,7,9b-hexahydro-1H-pyrido[4,3-b]indol-5-yl)-2-oxoethyl]sulfanyl-1,3-dimethylpurine-2,6-dione |
| SMILES | CCOc1ccc(Cn2c(SCC(=O)N3C4=C(C=C(C)CC4)C4CN(C)CCC43)nc3c2c(=O)n(C)c(=O)n3C)cc1OCC |
| InChI | InChI=1S/C33H42N6O5S/c1-7-43-26-12-10-21(16-27(26)44-8-2)17-38-29-30(36(5)33(42)37(6)31(29)41)34-32(38)45-19-28(40)39-24-11-9-20(3)15-22(24)23-18-35(4)14-13-25(23)39/h10,12,15-16,23,25H,7-9,11,13-14,17-19H2,1-6H3 |
| InChIKey | ZSNTWHJLMAGVTG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 103.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.80 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |