C24H30N6O3S — CID 4214403
8-[2-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-oxoethyl]sulfanyl-7-ethyl-1,3-dimethylpurine-2,6-dione (PubChem CID 4214403) has the molecular formula C24H30N6O3S and a molecular weight of 482.61 g/mol. Its IUPAC name is 8-[2-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-oxoethyl]sulfanyl-7-ethyl-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-[2-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-oxoethyl]sulfanyl-7-ethyl-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 4214403 |
| Molecular Formula | C24H30N6O3S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 8-[2-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-oxoethyl]sulfanyl-7-ethyl-1,3-dimethylpurine-2,6-dione |
| SMILES | CCn1c(SCC(=O)N2c3ccc(C)cc3C3CN(C)CCC32)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C24H30N6O3S/c1-6-29-20-21(27(4)24(33)28(5)22(20)32)25-23(29)34-13-19(31)30-17-8-7-14(2)11-15(17)16-12-26(3)10-9-18(16)30/h7-8,11,16,18H,6,9-10,12-13H2,1-5H3 |
| InChIKey | APLKBJAQBJRJIP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 85.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |