C24H28N4O3S — CID 70892404
(1R,2R,4R,5R)-4-hydroxy-2,5-dimethyl-4-[5-[3-methyl-5-[(4-methylpyrimidin-2-yl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid (PubChem CID 70892404) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is (1R,2R,4R,5R)-4-hydroxy-2,5-dimethyl-4-[5-[3-methyl-5-[(4-methylpyrimidin-2-yl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid.
| Compound Name | (1R,2R,4R,5R)-4-hydroxy-2,5-dimethyl-4-[5-[3-methyl-5-[(4-methylpyrimidin-2-yl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 70892404 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (1R,2R,4R,5R)-4-hydroxy-2,5-dimethyl-4-[5-[3-methyl-5-[(4-methylpyrimidin-2-yl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cc(Nc2nccc(C)n2)cc(-c2cnc([C@@]3(O)C[C@@H](C)[C@H](C(=O)O)C[C@H]3C)s2)c1 |
| InChI | InChI=1S/C24H28N4O3S/c1-13-7-17(10-18(8-13)28-23-25-6-5-16(4)27-23)20-12-26-22(32-20)24(31)11-14(2)19(21(29)30)9-15(24)3/h5-8,10,12,14-15,19,31H,9,11H2,1-4H3,(H,29,30)(H,25,27,28)/t14-,15-,19-,24-/m1/s1 |
| InChIKey | SVMDAWJZKBWHIG-NGBFXSCGSA-N |
| XLogP | 4.91 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |