C21H32O5 — CID 70895453
methyl (4S)-4-[(1R,4S)-5,6,8-trimethoxy-4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]pentanoate (PubChem CID 70895453) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is methyl (4S)-4-[(1R,4S)-5,6,8-trimethoxy-4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]pentanoate.
| Compound Name | methyl (4S)-4-[(1R,4S)-5,6,8-trimethoxy-4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]pentanoate |
|---|---|
| PubChem CID | 70895453 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | methyl (4S)-4-[(1R,4S)-5,6,8-trimethoxy-4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]pentanoate |
| SMILES | COC(=O)CC[C@H](C)[C@H]1CC[C@H](C)c2c(OC)c(OC)c(C)c(OC)c21 |
| InChI | InChI=1S/C21H32O5/c1-12(9-11-16(22)23-4)15-10-8-13(2)17-18(15)19(24-5)14(3)20(25-6)21(17)26-7/h12-13,15H,8-11H2,1-7H3/t12-,13-,15+/m0/s1 |
| InChIKey | AQXWZGWEMOEOEL-KCQAQPDRSA-N |
| XLogP | 4.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |