C21H19N5O6 — CID 70896407
1-(4-benzoyl-2-methylpiperazin-1-yl)-2-(7-hydroxy-4-nitropyrrolo[2,3-b]pyridin-3-yl)ethane-1,2-dione (PubChem CID 70896407) has the molecular formula C21H19N5O6 and a molecular weight of 437.41 g/mol. Its IUPAC name is 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-(7-hydroxy-4-nitropyrrolo[2,3-b]pyridin-3-yl)ethane-1,2-dione.
| Compound Name | 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-(7-hydroxy-4-nitropyrrolo[2,3-b]pyridin-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 70896407 |
| Molecular Formula | C21H19N5O6 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-(7-hydroxy-4-nitropyrrolo[2,3-b]pyridin-3-yl)ethane-1,2-dione |
| SMILES | CC1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1cnc2n(O)ccc([N+](=O)[O-])c1-2 |
| InChI | InChI=1S/C21H19N5O6/c1-13-12-23(20(28)14-5-3-2-4-6-14)9-10-24(13)21(29)18(27)15-11-22-19-17(15)16(26(31)32)7-8-25(19)30/h2-8,11,13,30H,9-10,12H2,1H3 |
| InChIKey | SDQDEONBYMWYNS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|