C22H21N5O5 — CID 142081962
1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(4-nitro-1,5-dihydropyrrolo[2,3-b]azepin-3-yl)ethane-1,2-dione (PubChem CID 142081962) has the molecular formula C22H21N5O5 and a molecular weight of 435.44 g/mol. Its IUPAC name is 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(4-nitro-1,5-dihydropyrrolo[2,3-b]azepin-3-yl)ethane-1,2-dione.
| Compound Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(4-nitro-1,5-dihydropyrrolo[2,3-b]azepin-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 142081962 |
| Molecular Formula | C22H21N5O5 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(4-nitro-1,5-dihydropyrrolo[2,3-b]azepin-3-yl)ethane-1,2-dione |
| SMILES | C[C@@H]1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1c[nH]c2c1=C([N+](=O)[O-])CC=CN=2 |
| InChI | InChI=1S/C22H21N5O5/c1-14-13-25(21(29)15-6-3-2-4-7-15)10-11-26(14)22(30)19(28)16-12-24-20-18(16)17(27(31)32)8-5-9-23-20/h2-7,9,12,14H,8,10-11,13H2,1H3,(H,23,24)/t14-/m1/s1 |
| InChIKey | CQFPOZTUXRYIIS-CQSZACIVSA-N |
| XLogP | 0.49 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|