C24H27N3O2 — CID 70896703
1-(5-tert-butyl-2-methoxyphenyl)-1-[4-(pyridin-4-ylmethyl)phenyl]urea (PubChem CID 70896703) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-methoxyphenyl)-1-[4-(pyridin-4-ylmethyl)phenyl]urea.
| Compound Name | 1-(5-tert-butyl-2-methoxyphenyl)-1-[4-(pyridin-4-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 70896703 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 1-(5-tert-butyl-2-methoxyphenyl)-1-[4-(pyridin-4-ylmethyl)phenyl]urea |
| SMILES | COc1ccc(C(C)(C)C)cc1N(C(N)=O)c1ccc(Cc2ccncc2)cc1 |
| InChI | InChI=1S/C24H27N3O2/c1-24(2,3)19-7-10-22(29-4)21(16-19)27(23(25)28)20-8-5-17(6-9-20)15-18-11-13-26-14-12-18/h5-14,16H,15H2,1-4H3,(H2,25,28) |
| InChIKey | PRCKBCHUTPZVCC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |