C21H17F3N4O4 — CID 67505471
4-[3-[N-carbamoyl-2-methoxy-5-(trifluoromethyl)anilino]phenoxy]pyridine-2-carboxamide (PubChem CID 67505471) has the molecular formula C21H17F3N4O4 and a molecular weight of 446.39 g/mol. Its IUPAC name is 4-[3-[N-carbamoyl-2-methoxy-5-(trifluoromethyl)anilino]phenoxy]pyridine-2-carboxamide.
| Compound Name | 4-[3-[N-carbamoyl-2-methoxy-5-(trifluoromethyl)anilino]phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 67505471 |
| Molecular Formula | C21H17F3N4O4 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 4-[3-[N-carbamoyl-2-methoxy-5-(trifluoromethyl)anilino]phenoxy]pyridine-2-carboxamide |
| SMILES | COc1ccc(C(F)(F)F)cc1N(C(N)=O)c1cccc(Oc2ccnc(C(N)=O)c2)c1 |
| InChI | InChI=1S/C21H17F3N4O4/c1-31-18-6-5-12(21(22,23)24)9-17(18)28(20(26)30)13-3-2-4-14(10-13)32-15-7-8-27-16(11-15)19(25)29/h2-11H,1H3,(H2,25,29)(H2,26,30) |
| InChIKey | FNPVOVAHGIJOBN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |