C21H16F3N3O4 — CID 11212599
2-methoxy-N'-(3-pyridin-4-yloxybenzoyl)-5-(trifluoromethyl)benzohydrazide (PubChem CID 11212599) has the molecular formula C21H16F3N3O4 and a molecular weight of 431.37 g/mol. Its IUPAC name is 2-methoxy-N'-(3-pyridin-4-yloxybenzoyl)-5-(trifluoromethyl)benzohydrazide.
| Compound Name | 2-methoxy-N'-(3-pyridin-4-yloxybenzoyl)-5-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 11212599 |
| Molecular Formula | C21H16F3N3O4 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2-methoxy-N'-(3-pyridin-4-yloxybenzoyl)-5-(trifluoromethyl)benzohydrazide |
| SMILES | COc1ccc(C(F)(F)F)cc1C(=O)NNC(=O)c1cccc(Oc2ccncc2)c1 |
| InChI | InChI=1S/C21H16F3N3O4/c1-30-18-6-5-14(21(22,23)24)12-17(18)20(29)27-26-19(28)13-3-2-4-16(11-13)31-15-7-9-25-10-8-15/h2-12H,1H3,(H,26,28)(H,27,29) |
| InChIKey | SLCMKANQOWOFQV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|