C16H15ClN2O4 — CID 8637145
N'-(3-chlorobenzoyl)-2,5-dimethoxybenzohydrazide (PubChem CID 8637145) has the molecular formula C16H15ClN2O4 and a molecular weight of 334.76 g/mol. Its IUPAC name is N'-(3-chlorobenzoyl)-2,5-dimethoxybenzohydrazide.
| Compound Name | N'-(3-chlorobenzoyl)-2,5-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 8637145 |
| Molecular Formula | C16H15ClN2O4 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N'-(3-chlorobenzoyl)-2,5-dimethoxybenzohydrazide |
| SMILES | COc1ccc(OC)c(C(=O)NNC(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C16H15ClN2O4/c1-22-12-6-7-14(23-2)13(9-12)16(21)19-18-15(20)10-4-3-5-11(17)8-10/h3-9H,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | RIORGJRZWOVGFW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|