C18H17N3O6 — CID 168567103
dimethyl (E)-2-[3-[(2-carbamoyl-4-pyridinyl)oxy]anilino]but-2-enedioate (PubChem CID 168567103) has the molecular formula C18H17N3O6 and a molecular weight of 371.35 g/mol. Its IUPAC name is dimethyl (E)-2-[3-[(2-carbamoyl-4-pyridinyl)oxy]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-[(2-carbamoyl-4-pyridinyl)oxy]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567103 |
| Molecular Formula | C18H17N3O6 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | dimethyl (E)-2-[3-[(2-carbamoyl-4-pyridinyl)oxy]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cccc(Oc2ccnc(C(N)=O)c2)c1)C(=O)OC |
| InChI | InChI=1S/C18H17N3O6/c1-25-16(22)10-15(18(24)26-2)21-11-4-3-5-12(8-11)27-13-6-7-20-14(9-13)17(19)23/h3-10,21H,1-2H3,(H2,19,23)/b15-10+ |
| InChIKey | MNSZQUGGXGALAZ-XNTDXEJSSA-N |
| XLogP | 1.61 |
| TPSA | 129.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|