C27H28BrNO6 — CID 7089673
2-phenoxyethyl (4S)-4-(2-bromo-4,5-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7089673) has the molecular formula C27H28BrNO6 and a molecular weight of 542.43 g/mol. Its IUPAC name is 2-phenoxyethyl (4S)-4-(2-bromo-4,5-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | 2-phenoxyethyl (4S)-4-(2-bromo-4,5-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7089673 |
| Molecular Formula | C27H28BrNO6 |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 2-phenoxyethyl (4S)-4-(2-bromo-4,5-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | COc1cc(Br)c([C@@H]2C3=C(CCCC3=O)N=C(C)C2C(=O)OCCOc2ccccc2)cc1OC |
| InChI | InChI=1S/C27H28BrNO6/c1-16-24(27(31)35-13-12-34-17-8-5-4-6-9-17)25(26-20(29-16)10-7-11-21(26)30)18-14-22(32-2)23(33-3)15-19(18)28/h4-6,8-9,14-15,24-25H,7,10-13H2,1-3H3/t24?,25-/m0/s1 |
| InChIKey | XBSSMKGGPGUJNH-BBMPLOMVSA-N |
| XLogP | 5.27 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|