C34H46ClN3O4 — CID 70900239
3-[[4-[1-[4-(3-chlorophenyl)-2-methyl-5-oxo-2-(3,4,4-trimethylpentyl)imidazol-1-yl]hexyl]benzoyl]amino]propanoic acid (PubChem CID 70900239) has the molecular formula C34H46ClN3O4 and a molecular weight of 596.21 g/mol. Its IUPAC name is 3-[[4-[1-[4-(3-chlorophenyl)-2-methyl-5-oxo-2-(3,4,4-trimethylpentyl)imidazol-1-yl]hexyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[1-[4-(3-chlorophenyl)-2-methyl-5-oxo-2-(3,4,4-trimethylpentyl)imidazol-1-yl]hexyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70900239 |
| Molecular Formula | C34H46ClN3O4 |
| Molecular Weight | 596.21 g/mol |
| Exact Mass | 595.32 |
| IUPAC Name | 3-[[4-[1-[4-(3-chlorophenyl)-2-methyl-5-oxo-2-(3,4,4-trimethylpentyl)imidazol-1-yl]hexyl]benzoyl]amino]propanoic acid |
| SMILES | CCCCCC(c1ccc(C(=O)NCCC(=O)O)cc1)N1C(=O)C(c2cccc(Cl)c2)=NC1(C)CCC(C)C(C)(C)C |
| InChI | InChI=1S/C34H46ClN3O4/c1-7-8-9-13-28(24-14-16-25(17-15-24)31(41)36-21-19-29(39)40)38-32(42)30(26-11-10-12-27(35)22-26)37-34(38,6)20-18-23(2)33(3,4)5/h10-12,14-17,22-23,28H,7-9,13,18-21H2,1-6H3,(H,36,41)(H,39,40) |
| InChIKey | YJARETOEZALRFV-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.21 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|