C27H36BN2O3S — CID 70900342
CID 70900342 (PubChem CID 70900342) has the molecular formula C27H36BN2O3S and a molecular weight of 479.48 g/mol.
| Compound Name | CID 70900342 |
|---|---|
| PubChem CID | 70900342 |
| Molecular Formula | C27H36BN2O3S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | — |
| SMILES | C[B]c1ccc(C2NC3(CCC(C(C)(C)C)CC3)N(CCc3ccc(C(=O)OC)cc3)C2=O)s1 |
| InChI | InChI=1S/C27H36BN2O3S/c1-26(2,3)20-12-15-27(16-13-20)29-23(21-10-11-22(28-4)34-21)24(31)30(27)17-14-18-6-8-19(9-7-18)25(32)33-5/h6-11,20,23,29H,12-17H2,1-5H3 |
| InChIKey | PTMPGLPBPYFMCS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|