methyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate

C13H14N2O3 — CID 91320640

IUPACmethyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate
SMILESCOC(=O)c1ccc(CCc2cc(=O)[nH][nH]2)cc1
InChIInChI=1S/C13H14N2O3/c1-18-13(17)10-5-2-9(3-6-10)4-7-11-8-12(16)15-14-11/h2-3,5-6,8H,4,7H2,1H3,(H2,14,15,16)
InChIKeyPIJMCOOLSPBJRD-UHFFFAOYSA-N
MW246.27 g/mol
LogP1.27
Rot. Bonds4

About methyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate

methyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate (PubChem CID 91320640) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is methyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate
PubChem CID91320640
Molecular FormulaC13H14N2O3
Molecular Weight246.27 g/mol
Exact Mass246.10
IUPAC Namemethyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate
SMILESCOC(=O)c1ccc(CCc2cc(=O)[nH][nH]2)cc1
InChIInChI=1S/C13H14N2O3/c1-18-13(17)10-5-2-9(3-6-10)4-7-11-8-12(16)15-14-11/h2-3,5-6,8H,4,7H2,1H3,(H2,14,15,16)
InChIKeyPIJMCOOLSPBJRD-UHFFFAOYSA-N
XLogP1.27
TPSA74.95 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.27
LogP ≤ 51.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze methyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate?
The IUPAC name of methyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate (CID 91320640) is methyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate.
What is the SMILES notation for methyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate?
The canonical SMILES for methyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate is COC(=O)c1ccc(CCc2cc(=O)[nH][nH]2)cc1.
What is the InChIKey of methyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate?
The InChIKey is PIJMCOOLSPBJRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3/c1-18-13(17)10-5-2-9(3-6-10)4-7-11-8-12(16)15-14-11/h2-3,5-6,8H,4,7H2,1H3,(H2,14,15,16).
What are the key properties of methyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate?
methyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate has a molecular weight of 246.27 g/mol, XLogP of 1.27, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl]benzoate is sourced from PubChem (CID 91320640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).