C17H16F2O2 — CID 134272989
methyl 4-[2-(2,6-difluoro-4-methylphenyl)ethyl]benzoate (PubChem CID 134272989) has the molecular formula C17H16F2O2 and a molecular weight of 290.31 g/mol. Its IUPAC name is methyl 4-[2-(2,6-difluoro-4-methylphenyl)ethyl]benzoate.
| Compound Name | methyl 4-[2-(2,6-difluoro-4-methylphenyl)ethyl]benzoate |
|---|---|
| PubChem CID | 134272989 |
| Molecular Formula | C17H16F2O2 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | methyl 4-[2-(2,6-difluoro-4-methylphenyl)ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCc2c(F)cc(C)cc2F)cc1 |
| InChI | InChI=1S/C17H16F2O2/c1-11-9-15(18)14(16(19)10-11)8-5-12-3-6-13(7-4-12)17(20)21-2/h3-4,6-7,9-10H,5,8H2,1-2H3 |
| InChIKey | CBJJPRIJBXYYMN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |