C18H15F3N2O3S — CID 70901253
3-[3,5-difluoro-4-[[4-(4-fluorophenyl)-2,3-dihydrothiadiazol-5-yl]methoxy]phenyl]propanoic acid (PubChem CID 70901253) has the molecular formula C18H15F3N2O3S and a molecular weight of 396.39 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-[[4-(4-fluorophenyl)-2,3-dihydrothiadiazol-5-yl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[3,5-difluoro-4-[[4-(4-fluorophenyl)-2,3-dihydrothiadiazol-5-yl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 70901253 |
| Molecular Formula | C18H15F3N2O3S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3-[3,5-difluoro-4-[[4-(4-fluorophenyl)-2,3-dihydrothiadiazol-5-yl]methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1cc(F)c(OCC2=C(c3ccc(F)cc3)NNS2)c(F)c1 |
| InChI | InChI=1S/C18H15F3N2O3S/c19-12-4-2-11(3-5-12)17-15(27-23-22-17)9-26-18-13(20)7-10(8-14(18)21)1-6-16(24)25/h2-5,7-8,22-23H,1,6,9H2,(H,24,25) |
| InChIKey | AEUDWZPAHNYTRB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|