C11H17N3O2 — CID 70903493
4-[4-(4-methyl-1,3-dioxetan-2-yl)pyrazol-1-yl]piperidine (PubChem CID 70903493) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 4-[4-(4-methyl-1,3-dioxetan-2-yl)pyrazol-1-yl]piperidine.
| Compound Name | 4-[4-(4-methyl-1,3-dioxetan-2-yl)pyrazol-1-yl]piperidine |
|---|---|
| PubChem CID | 70903493 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 4-[4-(4-methyl-1,3-dioxetan-2-yl)pyrazol-1-yl]piperidine |
| SMILES | CC1OC(c2cnn(C3CCNCC3)c2)O1 |
| InChI | InChI=1S/C11H17N3O2/c1-8-15-11(16-8)9-6-13-14(7-9)10-2-4-12-5-3-10/h6-8,10-12H,2-5H2,1H3 |
| InChIKey | OFFSRAUSMPJFEU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |