About 4-[(2R,4S,6R)-4-bromo-6-methyloxan-2-yl]-1-cyclopropylpyrazole
4-[(2R,4S,6R)-4-bromo-6-methyloxan-2-yl]-1-cyclopropylpyrazole (PubChem CID 157045012) has the molecular formula C12H17BrN2O
and a molecular weight of 285.19 g/mol. Its IUPAC name is 4-[(2R,4S,6R)-4-bromo-6-methyloxan-2-yl]-1-cyclopropylpyrazole.
Molecular Properties
| Compound Name | 4-[(2R,4S,6R)-4-bromo-6-methyloxan-2-yl]-1-cyclopropylpyrazole |
| PubChem CID | 157045012 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 4-[(2R,4S,6R)-4-bromo-6-methyloxan-2-yl]-1-cyclopropylpyrazole |
| SMILES | C[C@@H]1C[C@H](Br)C[C@H](c2cnn(C3CC3)c2)O1 |
| InChI | InChI=1S/C12H17BrN2O/c1-8-4-10(13)5-12(16-8)9-6-14-15(7-9)11-2-3-11/h6-8,10-12H,2-5H2,1H3/t8-,10+,12-/m1/s1 |
| InChIKey | KACPTJYHUDFYNI-UBHAPETDSA-N |
| XLogP | 3.22 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R,4S,6R)-4-bromo-6-methyloxan-2-yl]-1-cyclopropylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R,4S,6R)-4-bromo-6-methyloxan-2-yl]-1-cyclopropylpyrazole?
The IUPAC name of 4-[(2R,4S,6R)-4-bromo-6-methyloxan-2-yl]-1-cyclopropylpyrazole (CID 157045012) is 4-[(2R,4S,6R)-4-bromo-6-methyloxan-2-yl]-1-cyclopropylpyrazole.
What is the SMILES notation for 4-[(2R,4S,6R)-4-bromo-6-methyloxan-2-yl]-1-cyclopropylpyrazole?
The canonical SMILES for 4-[(2R,4S,6R)-4-bromo-6-methyloxan-2-yl]-1-cyclopropylpyrazole is C[C@@H]1C[C@H](Br)C[C@H](c2cnn(C3CC3)c2)O1.
What is the InChIKey of 4-[(2R,4S,6R)-4-bromo-6-methyloxan-2-yl]-1-cyclopropylpyrazole?
The InChIKey is KACPTJYHUDFYNI-UBHAPETDSA-N. The full InChI is InChI=1S/C12H17BrN2O/c1-8-4-10(13)5-12(16-8)9-6-14-15(7-9)11-2-3-11/h6-8,10-12H,2-5H2,1H3/t8-,10+,12-/m1/s1.
What are the key properties of 4-[(2R,4S,6R)-4-bromo-6-methyloxan-2-yl]-1-cyclopropylpyrazole?
4-[(2R,4S,6R)-4-bromo-6-methyloxan-2-yl]-1-cyclopropylpyrazole has a molecular weight of 285.19 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,4S,6R)-4-bromo-6-methyloxan-2-yl]-1-cyclopropylpyrazole is sourced from PubChem (CID 157045012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).