C20H15BrO — CID 70904894
6-bromo-3-cyclohexa-2,4-dien-1-yl-2-phenyl-1-benzofuran (PubChem CID 70904894) has the molecular formula C20H15BrO and a molecular weight of 351.24 g/mol. Its IUPAC name is 6-bromo-3-cyclohexa-2,4-dien-1-yl-2-phenyl-1-benzofuran.
| Compound Name | 6-bromo-3-cyclohexa-2,4-dien-1-yl-2-phenyl-1-benzofuran |
|---|---|
| PubChem CID | 70904894 |
| Molecular Formula | C20H15BrO |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 6-bromo-3-cyclohexa-2,4-dien-1-yl-2-phenyl-1-benzofuran |
| SMILES | Brc1ccc2c(C3C=CC=CC3)c(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C20H15BrO/c21-16-11-12-17-18(13-16)22-20(15-9-5-2-6-10-15)19(17)14-7-3-1-4-8-14/h1-7,9-14H,8H2 |
| InChIKey | QHYJSHMYXBGTOH-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |