C24H34N2O3 — CID 70906425
(4-but-2-ynyl-2-ethyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-(4-ethoxy-3-methylphenyl)methanone (PubChem CID 70906425) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is (4-but-2-ynyl-2-ethyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-(4-ethoxy-3-methylphenyl)methanone.
| Compound Name | (4-but-2-ynyl-2-ethyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-(4-ethoxy-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 70906425 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | (4-but-2-ynyl-2-ethyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-(4-ethoxy-3-methylphenyl)methanone |
| SMILES | CC#CCN1CC(CC)OC2(CCN(C(=O)c3ccc(OCC)c(C)c3)CC2)C1 |
| InChI | InChI=1S/C24H34N2O3/c1-5-8-13-25-17-21(6-2)29-24(18-25)11-14-26(15-12-24)23(27)20-9-10-22(28-7-3)19(4)16-20/h9-10,16,21H,6-7,11-15,17-18H2,1-4H3 |
| InChIKey | FOUHEGVNIOXMKB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|