C26H31N3O2 — CID 70907092
tert-butyl N-[4-[6-(piperidin-1-ylmethyl)-3-pyridinyl]naphthalen-1-yl]carbamate (PubChem CID 70907092) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is tert-butyl N-[4-[6-(piperidin-1-ylmethyl)-3-pyridinyl]naphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[4-[6-(piperidin-1-ylmethyl)-3-pyridinyl]naphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 70907092 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | tert-butyl N-[4-[6-(piperidin-1-ylmethyl)-3-pyridinyl]naphthalen-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2ccc(CN3CCCCC3)nc2)c2ccccc12 |
| InChI | InChI=1S/C26H31N3O2/c1-26(2,3)31-25(30)28-24-14-13-21(22-9-5-6-10-23(22)24)19-11-12-20(27-17-19)18-29-15-7-4-8-16-29/h5-6,9-14,17H,4,7-8,15-16,18H2,1-3H3,(H,28,30) |
| InChIKey | XHNXTRRCKJGHKD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |