C11H13F3NO3- — CID 7090795
(E)-4-oxo-4-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoate (PubChem CID 7090795) has the molecular formula C11H13F3NO3- and a molecular weight of 264.22 g/mol. Its IUPAC name is (E)-4-oxo-4-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoate.
| Compound Name | (E)-4-oxo-4-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 7090795 |
| Molecular Formula | C11H13F3NO3- |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (E)-4-oxo-4-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoate |
| SMILES | O=C([O-])/C=C/C(=O)N[C@H]1CCC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C11H14F3NO3/c12-11(13,14)7-2-1-3-8(6-7)15-9(16)4-5-10(17)18/h4-5,7-8H,1-3,6H2,(H,15,16)(H,17,18)/p-1/b5-4+/t7-,8+/m1/s1 |
| InChIKey | GKEVMNYXOTYLMG-VWFQECGMSA-M |
| XLogP | 0.53 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|