C32H20N6 — CID 70909562
2,4,7,9-tetrapyridin-4-yl-1,10-phenanthroline (PubChem CID 70909562) has the molecular formula C32H20N6 and a molecular weight of 488.55 g/mol. Its IUPAC name is 2,4,7,9-tetrapyridin-4-yl-1,10-phenanthroline.
| Compound Name | 2,4,7,9-tetrapyridin-4-yl-1,10-phenanthroline |
|---|---|
| PubChem CID | 70909562 |
| Molecular Formula | C32H20N6 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 2,4,7,9-tetrapyridin-4-yl-1,10-phenanthroline |
| SMILES | c1cc(-c2cc(-c3ccncc3)c3ccc4c(-c5ccncc5)cc(-c5ccncc5)nc4c3n2)ccn1 |
| InChI | InChI=1S/C32H20N6/c1-2-26-28(22-5-13-34-14-6-22)20-30(24-9-17-36-18-10-24)38-32(26)31-25(1)27(21-3-11-33-12-4-21)19-29(37-31)23-7-15-35-16-8-23/h1-20H |
| InChIKey | IYJPNWFCUYSZSU-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|