C16H31NO — CID 70910476
2-(2-cyclopentylethyl)-N-ethyl-4,4-dimethylpentanamide (PubChem CID 70910476) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is 2-(2-cyclopentylethyl)-N-ethyl-4,4-dimethylpentanamide.
| Compound Name | 2-(2-cyclopentylethyl)-N-ethyl-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 70910476 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 2-(2-cyclopentylethyl)-N-ethyl-4,4-dimethylpentanamide |
| SMILES | CCNC(=O)C(CCC1CCCC1)CC(C)(C)C |
| InChI | InChI=1S/C16H31NO/c1-5-17-15(18)14(12-16(2,3)4)11-10-13-8-6-7-9-13/h13-14H,5-12H2,1-4H3,(H,17,18) |
| InChIKey | PFQIRPLUUKYJGF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |