C13H23NO — CID 89093747
2-(2-cyclopropylethyl)-N-ethyl-4-methylpent-4-enamide (PubChem CID 89093747) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 2-(2-cyclopropylethyl)-N-ethyl-4-methylpent-4-enamide.
| Compound Name | 2-(2-cyclopropylethyl)-N-ethyl-4-methylpent-4-enamide |
|---|---|
| PubChem CID | 89093747 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2-(2-cyclopropylethyl)-N-ethyl-4-methylpent-4-enamide |
| SMILES | C=C(C)CC(CCC1CC1)C(=O)NCC |
| InChI | InChI=1S/C13H23NO/c1-4-14-13(15)12(9-10(2)3)8-7-11-5-6-11/h11-12H,2,4-9H2,1,3H3,(H,14,15) |
| InChIKey | JSRYBVKXFLSCNQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|