C20H34N2O3 — CID 70911430
2-amino-2-[2-[3-methyl-4-(3-piperidin-1-ylpropoxy)phenyl]ethyl]propane-1,3-diol (PubChem CID 70911430) has the molecular formula C20H34N2O3 and a molecular weight of 350.50 g/mol. Its IUPAC name is 2-amino-2-[2-[3-methyl-4-(3-piperidin-1-ylpropoxy)phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[2-[3-methyl-4-(3-piperidin-1-ylpropoxy)phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 70911430 |
| Molecular Formula | C20H34N2O3 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | 2-amino-2-[2-[3-methyl-4-(3-piperidin-1-ylpropoxy)phenyl]ethyl]propane-1,3-diol |
| SMILES | Cc1cc(CCC(N)(CO)CO)ccc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C20H34N2O3/c1-17-14-18(8-9-20(21,15-23)16-24)6-7-19(17)25-13-5-12-22-10-3-2-4-11-22/h6-7,14,23-24H,2-5,8-13,15-16,21H2,1H3 |
| InChIKey | ZCCAYDLILUDOJK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|