C29H36IN3O5 — CID 70911646
1-[[4-[5-[3-iodo-4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]-4-(2-methoxyethoxymethyl)piperidine-4-carboxylic acid (PubChem CID 70911646) has the molecular formula C29H36IN3O5 and a molecular weight of 633.53 g/mol. Its IUPAC name is 1-[[4-[5-[3-iodo-4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]-4-(2-methoxyethoxymethyl)piperidine-4-carboxylic acid.
| Compound Name | 1-[[4-[5-[3-iodo-4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]-4-(2-methoxyethoxymethyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 70911646 |
| Molecular Formula | C29H36IN3O5 |
| Molecular Weight | 633.53 g/mol |
| Exact Mass | 633.17 |
| IUPAC Name | 1-[[4-[5-[3-iodo-4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]-4-(2-methoxyethoxymethyl)piperidine-4-carboxylic acid |
| SMILES | COCCOCC1(C(=O)O)CCN(Cc2ccc(-c3noc(-c4ccc(CC(C)C)c(I)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C29H36IN3O5/c1-20(2)16-23-8-9-24(17-25(23)30)27-31-26(32-38-27)22-6-4-21(5-7-22)18-33-12-10-29(11-13-33,28(34)35)19-37-15-14-36-3/h4-9,17,20H,10-16,18-19H2,1-3H3,(H,34,35) |
| InChIKey | DNNVCTHTAQCOJA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|