C29H27N3O5 — CID 25123396
1-[[4-[5-(4-benzylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-4,4-dicarboxylic acid (PubChem CID 25123396) has the molecular formula C29H27N3O5 and a molecular weight of 497.55 g/mol. Its IUPAC name is 1-[[4-[5-(4-benzylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-4,4-dicarboxylic acid.
| Compound Name | 1-[[4-[5-(4-benzylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-4,4-dicarboxylic acid |
|---|---|
| PubChem CID | 25123396 |
| Molecular Formula | C29H27N3O5 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 1-[[4-[5-(4-benzylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-4,4-dicarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)CCN(Cc2ccc(-c3noc(-c4ccc(Cc5ccccc5)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C29H27N3O5/c33-27(34)29(28(35)36)14-16-32(17-15-29)19-22-8-10-23(11-9-22)25-30-26(37-31-25)24-12-6-21(7-13-24)18-20-4-2-1-3-5-20/h1-13H,14-19H2,(H,33,34)(H,35,36) |
| InChIKey | NMAOWDQTGPYMFF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|