C28H32ClN3O5 — CID 67545695
1-[[4-[5-(4-cyclohexylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-3,3-dicarboxylic acid;hydrochloride (PubChem CID 67545695) has the molecular formula C28H32ClN3O5 and a molecular weight of 526.03 g/mol. Its IUPAC name is 1-[[4-[5-(4-cyclohexylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-3,3-dicarboxylic acid;hydrochloride.
| Compound Name | 1-[[4-[5-(4-cyclohexylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-3,3-dicarboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 67545695 |
| Molecular Formula | C28H32ClN3O5 |
| Molecular Weight | 526.03 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 1-[[4-[5-(4-cyclohexylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-3,3-dicarboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1(C(=O)O)CCCN(Cc2ccc(-c3noc(-c4ccc(C5CCCCC5)cc4)n3)cc2)C1 |
| InChI | InChI=1S/C28H31N3O5.ClH/c32-26(33)28(27(34)35)15-4-16-31(18-28)17-19-7-9-22(10-8-19)24-29-25(36-30-24)23-13-11-21(12-14-23)20-5-2-1-3-6-20;/h7-14,20H,1-6,15-18H2,(H,32,33)(H,34,35);1H |
| InChIKey | GASPSXMDDMWNJS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.03 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|